| Identification | |
| Name: | 3-Pyridazinecarbonitrile,6-chloro- |
| Synonyms: | 3-Chloro-6-cyanopyridazine;6-Chloro-3-cyanopyridazine;6-Chloro-3-pyridazinecarbonitrile; |
| CAS: | 35857-89-7 |
| Molecular Formula: | C5H2ClN3 |
| Molecular Weight: | 139.54248 |
| InChI: | InChI=1/C5H2ClN3/c6-5-2-1-4(3-7)8-9-5/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.43g/cm3 |
| Refractive index: | 1.568 |
| Specification: |
The cas register number of 6-Chloro-3-pyridazinecarbonitrile is 35857-89-7. It also can be called as 3-Pyridazinecarbonitrile, 6-chloro- and the Systematic name about this chemical is 6-chloropyridazine-3-carbonitrile. Physical properties about 6-Chloro-3-pyridazinecarbonitrile are: (1)ACD/BCF (pH 5.5): 1; (2)ACD/BCF (pH 7.4): 1; (3)ACD/KOC (pH 5.5): 22.38; (4)ACD/KOC (pH 7.4): 22.38; (5)#H bond acceptors: 3; (6)#H bond donors: 0; (7)#Freely Rotating Bonds: 0; (8)Polar Surface Area: 49.57Å2; (9)Index of Refraction: 1.568; (10)Molar Refractivity: 31.745 cm3; (11)Molar Volume: 97.011 cm3; (12)Surface Tension: 70.653 dyne/cm; (13)Density: 1.438 g/cm3; (14)Flash Point: 156.465 °C; (15)Enthalpy of Vaporization: 57.813 kJ/mol; (16)Boiling Point: 335.103 °C at 760 mmHg; (17)Vapour Pressure: 0 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
