| Identification |
| Name: | L-Cysteine,N-acetyl-S-(2,4-dinitrophenyl)- |
| Synonyms: | N-Acetyl-S-2,4-dinitrophenyl-L-cysteine;S-(2,4-Dinitrophenyl)mercapturic acid; |
| CAS: | 35897-25-7 |
| Molecular Formula: | C11H11N3O7S |
| Molecular Weight: | 329.29 |
| InChI: | InChI=1/C11H11N3O7S/c1-6(15)12-8(11(16)17)5-22-10-3-2-7(13(18)19)4-9(10)14(20)21/h2-4,8H,5H2,1H3,(H,12,15)(H,16,17)/t8-/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 328.2°C |
| Boiling Point: | 619.1°Cat760mmHg |
| Density: | 1.57g/cm3 |
| Refractive index: | 1.639 |
| Appearance: | Bright Yellow Solid |
| Flash Point: | 328.2°C |
| Usage: | Used as a marker for low levels of exposure to benzene in industry |
| Safety Data |
| |
 |
