Identification |
Name: | Benzoic acid,3,4,5-trimethoxy-,1,1'-[(tetrahydro-1H-1,4-diazepine-1,4(5H)-diyl)di-3,1-propanediyl] ester |
Synonyms: | Benzoicacid, 3,4,5-trimethoxy-, (tetrahydro-1H-1,4-diazepine-1,4(5H)-diyl)di-3,1-propanediylester (9CI); 1H-1,4-Diazepine, benzoic acid deriv.; AS 05; AS 05(cardioprotective); Dilazep |
CAS: | 35898-87-4 |
Molecular Formula: | C31H44 N2 O10 |
Molecular Weight: | 677.61 |
InChI: | InChI=1/C31H44N2O10/c1-36-24-18-22(19-25(37-2)28(24)40-5)30(34)42-16-8-12-32-10-7-11-33(15-14-32)13-9-17-43-31(35)23-20-26(38-3)29(41-6)27(21-23)39-4/h18-21H,7-17H2,1-6H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 344.5°C |
Boiling Point: | 646°Cat760mmHg |
Density: | 1.156g/cm3 |
Biological Activity: | Coronary and cerebral vasodilator, suppresses the effects of ischemia. Inhibitor of platelet aggregation and of membrane transport of nucleosides. Inhibits adenosine uptake. |
Flash Point: | 344.5°C |
Storage Temperature: | 2-8°C |
Color: | white |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|