| Identification | |
| Name: | b-D-Ribofuranuronamide,1-(6-amino-9H-purin-9-yl)-1-deoxy-N-ethyl- |
| Synonyms: | 5'-N-Ethylcarboxamidoadenosine;5'-N6-Ethylcarboxamidoadenosine;744-96;Adenosine 5'-N-ethylcarboxamide;Adenosine 5'-ethylcarboxamide;D-NECA;NECA; |
| CAS: | 35920-39-9 |
| Molecular Formula: | C12H16 N6 O4 |
| Molecular Weight: | 317.35 |
| InChI: | InChI=1/C12H16N6O4/c1-2-14-11(21)8-6(19)7(20)12(22-8)18-4-17-5-9(13)15-3-16-10(5)18/h3-4,6-8,12,19-20H,2H2,1H3,(H,14,21)(H2,13,15,16)/t6-,7?,8+,12-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 2 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.87g/cm3 |
| Refractive index: | 1.829 |
| Appearance: | powder |
| Packinggroup: | I |
| Biological Activity: | Potent adenosine receptor agonist (K i values are 14, 20 and 6.2 nM for human A 1 , A 2A and A 3 receptors respectively; EC 50 = 2.4 μ M for human A 2B ). Inhibits platelet aggregation and is centrally active in vivo . |
| Flash Point: | °C |
| Storage Temperature: | 2-8°C |
| Color: | white |
| Usage: | A potent adenosine receptor agonist. Inhibits platelet aggregation and is centrally active in vivo |
| Safety Data | |
| Hazard Symbols |
T+: Very toxic
|
 |
|
