| Identification | |
| Name: | 4-Piperidinone,1-cyclobutyl- |
| Synonyms: | 1-Cyclobutyl-4-piperidone; |
| CAS: | 359880-05-0 |
| Molecular Formula: | C9H15NO |
| Molecular Weight: | 153.22 |
| InChI: | InChI=1/C9H15NO/c11-9-4-6-10(7-5-9)8-2-1-3-8/h8H,1-7H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.105 g/cm3 |
| Refractive index: | 1.536 |
| Specification: |
The N-Cyclobutyl-4-piperidone with the cas number 359880-05-0 is also called 4-piperidinone, 1-cyclobutyl-. The systematic name is 1-cyclobutylpiperidin-4-one. Its molecular formula is C9H15NO. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 0.84; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 7; (7)#H bond acceptors: 2; (8)#H bond donors: 0; (9)#Freely Rotating Bonds: 1; (10)Polar Surface Area: 20.31 Å2; (11)Index of Refraction: 1.536; (12)Molar Refractivity: 43.246 cm3; (13)Molar Volume: 138.642 cm3; (14)Polarizability: 17.144×10-24cm3; (15)Surface Tension: 45.908 dyne/cm; (16)Enthalpy of Vaporization: 49.123 kJ/mol; (17)Vapour Pressure: 0.018 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
