| Identification | |
| Name: | Benzenemethanol, a-(aminomethyl)-2,5-dimethoxy- |
| Synonyms: | Benzylalcohol, a-(aminomethyl)-2,5-dimethoxy-(7CI,8CI); 1-(2,5-Dimethoxyphenyl)-2-aminoethanol; Deglymidodrine;Desglymidodrine; ST 1059 |
| CAS: | 3600-87-1 |
| Molecular Formula: | C10H15 N O3 |
| Molecular Weight: | 197.23 |
| InChI: | InChI=1/C10H15NO3/c1-13-7-3-4-10(14-2)8(5-7)9(12)6-11/h3-5,9,12H,6,11H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 174.1°C |
| Boiling Point: | 364.3°Cat760mmHg |
| Density: | g/cm3 |
| Refractive index: | 1.542 |
| Specification: |
2-Amino-1-(2,5-dimethoxyphenyl)ethanol (CAS NO.3600-87-1), its Synonyms are Benzyl alcohol, alpha-(aminomethyl)-2,5-dimethoxy- ; alpha-(Aminomethyl)-2,5-dimethoxybenzenemethanol ; 1-(2',5'-Dimethoxyphenyl)aminoethanol ; ST-1059 ; Benzylalcohol, a-(aminomethyl)-2,5-dimethoxy-(7CI,8CI) ; 1-(2,5-Dimethoxyphenyl)-2-aminoethanol ; Deglymidodrine ; Desglymidodrine ; 2,5-Dimethoxyphenyl-2-hydroxyethylamine . |
| Flash Point: | 174.1°C |
| Usage: |
2-Amino-1-(2,5-dimethoxyphenyl)ethanol (CAS NO.3600-87-1) is used as a metabolite of Midodrine. It induces alpha-adrenergic receptor stimulation of both arterial and venous systems without direct central nervous systme of cardiac effects. |
| Safety Data | |
 |
|
