| Identification | |
| Name: | Butanedioic acid,2-(phenylmethyl)- |
| Synonyms: | 2-Benzylsuccinic acid; |
| CAS: | 36092-42-9 |
| Molecular Formula: | C11H12O4 |
| Molecular Weight: | 208.20 |
| InChI: | InChI=1/C11H12O4/c12-10(13)7-9(11(14)15)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,13)(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 168.4°C |
| Boiling Point: | 331.4°Cat760mmHg |
| Density: | 1.29g/cm3 |
| Refractive index: | 1.567 |
| Appearance: | White to off white powder |
| Flash Point: | 168.4°C |
| Usage: | An effective inhibitor of carboxypeptidase A |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
