| Identification | |
| Name: | 3-Thiophenecarboxylicacid, 5-chloro- |
| Synonyms: | 5-Chlorothiophene-3-carboxylicacid; |
| CAS: | 36157-42-3 |
| Molecular Formula: | C5H3ClO2S |
| Molecular Weight: | 162.59 |
| InChI: | InChI=1/C5H3ClO2S/c6-4-1-3(2-9-4)5(7)8/h1-2H,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.572 g/cm3 |
| Refractive index: | 1.623 |
| Specification: |
The 5-Chlorothiophene-3-carboxylic acid with the CAS number 36157-42-3 is also called 3-Thiophenecarboxylicacid, 5-chloro-. Its molecular formula is C5H3ClO2S. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 2.56; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.89; (4)ACD/LogD (pH 7.4): ; (5)ACD/BCF (pH 5.5): 1.11; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 12.53; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 54.54 Å2; (13)Index of Refraction: 1.623; (14)Molar Refractivity: 36.46 cm3; (15)Molar Volume: 103.3 cm3; (16)Polarizability: 14.45×10-24cm3; (17)Surface Tension: 60.5 dyne/cm; (18)Enthalpy of Vaporization: 55.57 kJ/mol; (19)Vapour Pressure: 0.00119 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
