| Identification | |
| Name: | Estra-1,3,5(10)-triene-2,3,17-triol,(17b)- |
| Synonyms: | Estra-1,3,5(10)-triene-2,3,17b-triol (7CI,8CI); 2,3,17b-Trihydroxyestra-1,3,5(10)-triene;2-Hydroxyestradiol; NSC 61711 |
| CAS: | 362-05-0 |
| Molecular Formula: | C18H24 O3 |
| Molecular Weight: | 288.42 |
| InChI: | InChI=1/C18H24O3/c1-18-7-6-11-12(14(18)4-5-17(18)21)3-2-10-8-15(19)16(20)9-13(10)11/h8-9,11-12,14,17,19-21H,2-7H2,1H3/t11-,12+,14-,17-,18-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 227.6°C |
| Boiling Point: | 481.5°Cat760mmHg |
| Density: | 1.248g/cm3 |
| Refractive index: | 1.622 |
| Specification: |
2-Hydroxyestradiol ,its cas register number is 362-05-0. It also can be called Estra-1,3,5(10)-triene-2,3,17-triol, (17.beta.)- ; 2,3,17b-Trihydroxyestra-1,3,5(10)-trienee ; and (17b)-Estra-1(10),2,4-triene-2,3,17-triol . |
| Flash Point: | 227.6°C |
| Storage Temperature: | −20°C |
| Usage: |
2-Hydroxyestradiol (CAS NO.362-05-0) has been used as a metabolite of Estradiol. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
