Identification |
Name: | Guanosine,2',3'-O-(1-methylethylidene)- |
Synonyms: | Guanosine,2',3'-O-isopropylidene- (6CI,7CI,8CI);Furo[3,4-d]-1,3-dioxole, guanosinederiv.;2',3'-Isopropylideneguanosine;2',3'-O-Isopropylideneguanosine;Isopropylideneguanosine; |
CAS: | 362-76-5 |
EINECS: | 206-651-9 |
Molecular Formula: | C13H17N5O5 |
Molecular Weight: | 323.30 |
InChI: | InChI=1/C13H17N5O5/c1-13(2)22-7-5(3-19)21-11(8(7)23-13)18-4-15-6-9(18)16-12(14)17-10(6)20/h4-5,7-8,11,19H,3H2,1-2H3,(H3,14,16,17,20)/t5-,7-,8-,11-/m1/s1 |
Molecular Structure: |
|
Properties |
Melting Point: | 296 °C |
Flash Point: | 345.1°C |
Boiling Point: | 647°Cat760mmHg |
Density: | 1.93g/cm3 |
Refractive index: | 1.828 |
Appearance: | White Crystalline Solid |
Flash Point: | 345.1°C |
Usage: | A useful precursor for the preparation of nucleic acids |
Safety Data |
|
|