| Identification | |
| Name: | Piperidine,4-(2-fluorophenoxy)- |
| Synonyms: | Piperidine,4-(o-fluorophenoxy)- (8CI); 4-(2-Fluorophenoxy)piperidine |
| CAS: | 3623-02-7 |
| Molecular Formula: | C11H14 F N O |
| Molecular Weight: | 195.23 |
| InChI: | InChI=1/C11H14FNO/c12-10-3-1-2-4-11(10)14-9-5-7-13-8-6-9/h1-4,9,13H,5-8H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 127.9°C |
| Boiling Point: | 287.9°C at 760 mmHg |
| Density: | 1.108g/cm3 |
| Refractive index: | 1.51 |
| Specification: |
The 4-(2-Fluorophenoxy)piperidine, with the CAS registry number 3623-02-7, is also known as Piperidine, 4-(2-fluorophenoxy)-. This chemical's molecular formula is C11H14FNO and formula weight is 195.23. What's more, its systematic name is called 4-(2-Fluorophenoxy)piperidine. Physical properties about this chemical are: (1)ACD/LogP: 2.12; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1.13; (7)#H bond acceptors: 2; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 2; (10)Polar Surface Area: 21.26 Å2; (11)Index of Refraction: 1.51; (12)Molar Refractivity: 52.69 cm3; (13)Molar Volume: 176.1 cm3; (14)Surface Tension: 35.9 dyne/cm; (15)Density: 1.108 g/cm3; (16)Flash Point: 127.9 °C; (17)Enthalpy of Vaporization: 52.71 kJ/mol; (18)Boiling Point: 287.9 °C at 760 mmHg; (19)Vapour Pressure: 0.00241 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 127.9°C |
| Safety Data | |
 |
|
