| Identification | |
| Name: | Benzaldehyde,3-bromo-4-methyl- |
| Synonyms: | p-Tolualdehyde,3-bromo- (6CI,7CI);3-Bromo-4-methylbenzaldehyde;3-Bromo-p-tolualdehyde; |
| CAS: | 36276-24-1 |
| Molecular Formula: | C8H7 Br O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H7BrO/c1-6-2-3-7(5-10)4-8(6)9/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 90.2°C |
| Boiling Point: | 254.1°Cat760mmHg |
| Density: | 1.49g/cm3 |
| Refractive index: | 1.597 |
| Specification: |
The Benzaldehyde,3-bromo-4-methyl-, with its cas register number 36276-24-1, has its IUPAC name of 3-bromo-4-methyl Benzalehyde. The characteristics of this chemical are as below: (1)ACD/LogP: 2.97 ; (2)#H bond acceptors: 1; (3)#Freely Rotating Bonds: 1; (4)Polar Surface Area: 17.07; (5)Index of Refraction: 1.597; (6)Molar Refractivity: 45.52 cm3; (7)Molar Volume: 133.5 cm3; (8)Polarizability: 18.04×10-24 cm3; (9)Surface Tension: 42.2 dyne/cm; (10)Density: 1.49 g/cm3; (11)Flash Point: 92.2 °C; (12)Enthalpy of Vaporization: 49.44 kJ/mol; (13)Boiling Point: 256.9 °C at 760 mmHg; (14)Vapour Pressure: 0.015 mmHg at 25°C. Additionally, you could convert the following data information to obtain the molecular structure: |
| Flash Point: | 90.2°C |
| Safety Data | |
 |
|
