| Identification | |
| Name: | Pentafluorobenzene |
| Synonyms: | Pentafluorobenzene(98+%min.); Pentafluorobenzenemin; 1,2,3,4,5-Pentafluorobenzene |
| CAS: | 363-72-4 |
| EINECS: | 206-658-7 |
| Molecular Formula: | C6HF5 |
| Molecular Weight: | 168.07 |
| InChI: | InChI=1/C6HF5/c7-2-1-3(8)5(10)6(11)4(2)9/h1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.514 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Highly flammable. |
| Refractive index: | 1.39-1.392 |
| Solubility: | Insoluble |
| Appearance: | clear colorless to light yellow liquid |
| Specification: |
Pentafluorobenzene (CAS NO.363-72-4) is also named as 1,2,3,4,5-Pentafluorobenzene ; NSC 88293 ; Benzene, 1,2,3,4,5-pentafluoro- ; Benzene, pentafluoro- . Pentafluorobenzene (CAS NO.363-72-4) is clear colorless to light yellow liquid. |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Flammables-area. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
