| Identification | |
| Name: | Benzene,1,3-bis(dibromomethyl)- |
| Synonyms: | m-Xylene, a,a,a',a'-tetrabromo- (6CI);1,3-Bis(dibromomethyl)benzene; NSC 76079; a,a,a',a'-Tetrabromo-m-xylene |
| CAS: | 36323-28-1 |
| EINECS: | 252-975-9 |
| Molecular Formula: | C8H6 Br4 |
| Molecular Weight: | 421.78 |
| InChI: | InChI=1/C8H6Br4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4,7-8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3448 6 |
| Density: | 2.392 g/cm3 |
| Refractive index: | 1.685 |
| Specification: |
Benzene, 1,3-bis(dibromomethyl)- , its cas register number is 36323-28-1. It also can be called 1,3-Bis(dibromomethyl)benzene ; and alpha,alpha,alpha',alpha'-Tetrabromo-m-xylene . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
