| Identification | |
| Name: | 1,1'-Biphenyl,hexabromo- |
| Synonyms: | Hexabromo-1,1'-biphenyl;Hexabromobiphenyl; Hexabromodiphenyl; RBF 075 |
| CAS: | 36355-01-8 |
| EINECS: | 252-994-2 |
| Molecular Formula: | C12H4 Br6 |
| Molecular Weight: | 627.62 |
| InChI: | InChI=1/C12H4Br6/c13-7-3-1-5(9(15)11(7)17)6-2-4-8(14)12(18)10(6)16/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3152 |
| Flash Point: | 237.8°C |
| Boiling Point: | 484.7°Cat760mmHg |
| Density: | 2.492g/cm3 |
| Refractive index: | 1.696 |
| Specification: |
1,2,3-Tribromo-4-(2,3,4-tribromophenyl)benzene with CAS number of 6355-01-8 is also called for Hexabromo-1’-biphenyl ; Hexabromo-bipheny ; Hexabromobiphenyl(unspecifiedlobationofbromines) ; Nci-c53634 ; Hexabromobiphenyl ; Polybrominated biphenyl ; Hexabromo-1,1'-biphenyl ; 1,1-Biphenyl, hexabromo- . |
| Report: |
Polybrominated biphenyl compounds are on the Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | 237.8°C |
| Safety Data | |
 |
|
