| Identification | |
| Name: | Benzoic acid,2-[(2-fluoroacetyl)oxy]- |
| Synonyms: | Benzoicacid, 2-[(fluoroacetyl)oxy]- (9CI); Salicylic acid, 2-fluoroacetate (8CI) |
| CAS: | 364-71-6 |
| EINECS: | 206-666-0 |
| Molecular Formula: | C9H7 F O4 |
| Molecular Weight: | 198.16 |
| InChI: | InChI=1/C9H7FO4/c10-5-8(11)14-7-4-2-1-3-6(7)9(12)13/h1-4H,5H2,(H,12,13) |
| Molecular Structure: | ![(C9H7FO4) Benzoicacid, 2-[(fluoroacetyl)oxy]- (9CI); Salicylic acid, 2-fluoroacetate (8CI)](https://img1.guidechem.com/chem/e/dict/46/364-71-6.jpg) |
| Properties | |
| Melting Point: | 90-94 °C(lit.) |
| Flash Point: | 152.9°C |
| Boiling Point: | 329.2°Cat760mmHg |
| Density: | 1.366g/cm3 |
| Refractive index: | 1.528 |
| Specification: |
O-(Fluoroacetyl)salicylic acid , its cas register number is 364-71-6. It also can be called Salicylic acid, fluoroacetate ; and BRN 3285002 . |
| Flash Point: | 152.9°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
