| Identification | |
| Name: | 4-Fluoro-3-nitroaniline |
| Synonyms: | Fluoronitroaniline4 |
| CAS: | 364-76-1 |
| EINECS: | 206-665-5 |
| Molecular Formula: | C6H5FN2O2 |
| Molecular Weight: | 156.12 |
| InChI: | InChI=1/C6H5FN2O2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1325 |
| Density: | 1.448 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.635 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble in water |
| Appearance: | white to light yellow crystal powder |
| Specification: |
?4-Fluoro-3-nitroaniline (CAS NO.364-76-1) is also named as 3-Nitro-4-fluoroaniline ; 4-12-00-01668 (Beilstein Handbook Reference) ; 4-Fluoro-3-nitrobenzenamine ; BRN 2210199 ; Benzenamine, 4-fluoro-3-nitro- ; NSC 10293 .?4-Fluoro-3-nitroaniline (CAS NO.364-76-1) is white to light yellow crystal powder.?It is?insoluble in water, soluble in benzene, toluene, ethanol and ether . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29214210 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
