| Identification | |
| Name: | 2',4'-Difluoroacetophenone |
| Synonyms: | Acetophenone,2',4'-difluoro- (6CI,8CI);1-(2,4-Difluorophenyl)ethanone;2,4-Difluorophenyl methyl ketone;2,4-Difluoroacetophenone;Ethanone,1-(2,4-difluorophenyl)-; |
| CAS: | 364-83-0 |
| EINECS: | 206-667-6 |
| Molecular Formula: | C8H6F2O |
| Molecular Weight: | 156.13 |
| InChI: | InChI=1/C8H6F2O/c1-5(11)7-3-2-6(9)4-8(7)10/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.234 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.487-1.489 |
| Water Solubility: | INSOLUBLE |
| Solubility: | INSOLUBLE |
| Appearance: | Clear colorless to yellow liquid |
| Specification: |
?2,4-Difluoroacetophenone (CAS NO.364-83-0), its Synonyms are Ethanone, 1-(2,4-difluorophenyl)- ; 1-(2,4-Difluorophenyl)ethan-1-one ; 2',4'-Difluoroacetophenone ; 1-(2,4-Difluorophenyl)ethanone . |
| HS Code: | 29147090 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Do not store in direct sunlight. Store in a tightly closed container. Keep under a nitrogen blanket. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
