| Identification |
| Name: | D-Gluconic acid,2-amino-2-deoxy- |
| Synonyms: | Gluconicacid, 2-amino-2-deoxy-, D- (8CI);2-Amino-2-deoxy-D-gluconic acid;D-Glucosamicacid;D-Glucosaminic acid;Glucosaminic acid;NSC 37779;NSC 404265; |
| CAS: | 3646-68-2 |
| EINECS: | 222-879-1 |
| Molecular Formula: | C6H13NO6 |
| Molecular Weight: | 195.17 |
| InChI: | InChI=1/C6H13NO6/c7-3(6(12)13)5(11)4(10)2(9)1-8/h2-5,8-11H,1,7H2,(H,12,13)/t2-,3-,4-,5-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 336.7°C |
| Boiling Point: | 633.2°C at 760 mmHg |
| Density: | 1.662g/cm3 |
| Refractive index: | -15 ° (C=2.5, 1mol/L HCl) |
| Appearance: | White Crystalline Solid |
| Flash Point: | 336.7°C |
| Storage Temperature: | 2-8°C |
| Usage: | A useful starting material for the synthesis of aldonic acids containing a free carboxyl group and having all hydroxyl functions esterified with a simple carboxylic acid are well established deriviatives |
| Safety Data |
| |
 |
