| Identification | |
| Name: | Hexabromodiphenyl ether |
| Synonyms: | Hexabromodiphenyl ethers;BR 33N;HSDB 7111;Hexabromodiphenyl ether;Hexabromodiphenyl oxide;Hexabromophenoxybenzene;Benzene, 1,1'-oxybis-, hexabromo deriv.;Diphenyl ether, hexabromo derivative;1,3,5-tribromo-2-(2,3,5-tribromophenoxy)benzene |
| CAS: | 36483-60-0 |
| EINECS: | 253-058-6 |
| Molecular Formula: | C12H4Br6O |
| Molecular Weight: | 643.5836 |
| InChI: | InChI=1/C12H4Br6O/c13-5-2-8(16)12(9(17)3-5)19-10-4-6(14)1-7(15)11(10)18/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 189°C |
| Boiling Point: | 454.4°C at 760 mmHg |
| Density: | 2.502g/cm3 |
| Refractive index: | 1.695 |
| Specification: |
Hexabromodiphenyl ether with cas registry number of 36483-60-0 is also called for BR 33N ; Benzene, 1,1'-oxybis-, hexabromo deriv. ; Diphenyl ether, hexabromo derivative ; HSDB 7111 ; Hexabromodiphenyl oxide ; Hexabromophenoxybenzene ; Hexabromodiphenyl ethers . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 189°C |
| Safety Data | |
 |
|
