| Identification | |
| Name: | 2-Bromocarbazole |
| Synonyms: | 9H-Carbazole, 2-bromo-;2-Bromocarbazole; |
| CAS: | 3652-90-2 |
| Molecular Formula: | C12H8BrN |
| Molecular Weight: | 246.10 |
| InChI: | InChI=1/C12H8BrN/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h1-7,14H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.617 g/cm3 |
| Refractive index: | 1.784 |
| Specification: |
The 2-Bromocarbazole with the CAS number 3652-90-2 is also called 9H-Carbazole, 2-bromo-. The systematic name is 2-bromo-9H-carbazole. Its molecular formula is C12H8BrN. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the 2-Bromocarbazole are: (1)ACD/LogP: 4.59; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4; (4)ACD/LogD (pH 7.4): 4; (5)ACD/BCF (pH 5.5): 1527; (6)ACD/BCF (pH 7.4): 1527; (7)ACD/KOC (pH 5.5): 6614; (8)ACD/KOC (pH 7.4): 6614; (9)#H bond acceptors: 1; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 15.79 Å2; (13)Index of Refraction: 1.784; (14)Molar Refractivity: 64.061 cm3; (15)Molar Volume: 152.172 cm3; (16)Polarizability: 25.396×10-24cm3; (17)Surface Tension: 60.866 dyne/cm; (18)Enthalpy of Vaporization: 63.566 kJ/mol; (19)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
