| Identification | |
| Name: | 4-chloro-O-tolyloxyacetic acid, sodium salt |
| Synonyms: | ((4-chloro-o-tolyl)oxy)-aceticacisodiumsalt; (2-methyl-4-chlorophenoxy)aceticacid,sodiumsalt; (4-chloro-2-methylphenoxy)-aceticacisodiumsalt; (p-chloro-o-tolyloxy)aceticacidsodiumsalt; 2m-4khsodiumsalt; 4-chloro-2-methylphenoxyaceticacidsodiumsalt; 4-chloro-o-tolyloxyaceticacid,sodiumsalt; Aceticacid,(4-chloro-2-methylphenoxy)-,sodiumsalt; 2-Methyl-4-chlorophenoxy acetic aid sodium salt; 2-Methyl-4-chlorophenoxyacetic acid sodium salt |
| CAS: | 3653-48-3 |
| EINECS: | 222-895-9 |
| Molecular Formula: | C9H9ClO3 |
| Molecular Weight: | 200.62 |
| InChI: | InChI=1/C9H9ClO3.Na/c1-6-4-7(10)2-3-8(6)13-5-9(11)12;/h2-4H,5H2,1H3,(H,11,12);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 118-119 deg C |
| Flash Point: | 151.6°C |
| Boiling Point: | 327°Cat760mmHg |
| Density: | g/cm3 |
| Solubility: | INSOL IN CARBON DISULFIDE; SOLUBILITY (G/100 ML): ETHER 77, ETHANOL 153, N-HEPTANE 0.5, TOLUENE 6.2, XYLENE 4.9 SOL IN CARBON TETRACHLORIDE Free acid insol in water but sodium and amine salts are soluble Sol in benzene Diethyl ether 770 mg/l In water, 630 mg/l @ 25 deg C |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 151.6°C |
| Color: | White to light brown solid flakes, crystal powder or liquid. Plates from benzene or toluene White crystalline solid (pure compd) Colorless crystalline solid (pure) |
| Safety Data | |
| Hazard Symbols |
Xn:有害物质
|
 |
|
