The Disodium lauriminodipropionate with the cas number 3655-00-3 is also called Disodium 3,3'-(dodecylimino)bis(propionate). The IUPAC name is disodium 3-[dodecyl-(3-oxido-3-oxopropyl)amino]propanoate. Its EINECS registry number is 222-899-0. The molecular formula is C18H33NNa2O4.
The properties of the chemical are: (1)ACD/LogP: 5.52; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 2.09; (4)ACD/LogD (pH 7.4): 2.02; (5)ACD/BCF (pH 5.5): 3.42; (6)ACD/BCF (pH 7.4): 2.91; (7)ACD/KOC (pH 5.5): 8.89; (8)ACD/KOC (pH 7.4): 7.57; (9)#H bond acceptors: 5; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 17; (12)Polar Surface Area: 77.84 Å2; (13)Enthalpy of Vaporization: 81.74 kJ/mol; (14)Vapour Pressure: 1.35×10-10 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: [Na+].[Na+].[O-]C(=O)CCN(CCCCCCCCCCCC)CCC([O-])=O
(2)InChI: InChI=1/C18H35NO4.2Na/c1-2-3-4-5-6-7-8-9-10-11-14-19(15-12-17(20)21)16-13-18(22)23;;/h2-16H2,1H3,(H,20,21)(H,22,23);;/q;2*+1/p-2
(3)InChIKey: KSDGSKVLUHKDAL-NUQVWONBAR
|