| Identification | |
| Name: | Carbonodithioic acid,O-(1-methylpropyl) ester, sodium salt (1:1) |
| Synonyms: | Carbonodithioicacid, O-(1-methylpropyl) ester, sodium salt (9CI); Xanthic acid, sec-butyl-,sodium salt (6CI); Sodium sec-butyl xanthate |
| CAS: | 36551-21-0 |
| EINECS: | 253-097-9 |
| Molecular Formula: | C5H10 O S2 . Na |
| Molecular Weight: | 172.25 |
| InChI: | InChI=1/C5H10OS2.Na/c1-3-4(2)6-5(7)8;/h4H,3H2,1-2H3,(H,7,8);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 51.7°C |
| Boiling Point: | 161.8°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Sodium sec-butyl xanthate , its cas register number is 36551-21-0. It also can be called sek.Butylxanthogenan sodny ; Xanthic acid, sec-butyl-, sodium salt ; Natrium-O-1-methylpropyldithiokarbonat ; and Carbonic acid, dithio-, O-sec-butyl ester, sodium salt . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 51.7°C |
| Safety Data | |
 |
|
