| Identification |
| Name: | 2-Propenoic acid, 2-methyl-, 2-(dimethylamino)ethyl ester, polymer with dodecyl 2-methyl-2-propenoate and methyl 2-methyl-2-propenoate |
| Synonyms: | 2-Propenoic acid, 2-methyl-, 2-(dimethylamino)ethyl ester, polymer with dodecyl 2-methyl-2-propenoate and methyl 2-methyl-2-propenoate |
| CAS: | 36657-47-3 |
| Molecular Formula: | C29H53NO6 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C16H30O2.C8H15NO2.C5H8O2/c1-4-5-6-7-8-9-10-11-12-13-14-18-16(17)15(2)3;1-7(2)8(10)11-6-5-9(3)4;1-4(2)5(6)7-3/h2,4-14H2,1,3H3;1,5-6H2,2-4H3;1H2,2-3H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 133.8°C |
| Boiling Point: | 322.7°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 133.8°C |
| Safety Data |
| |
 |
