| Identification |
| Name: | Ethanone,1-(2,4-dihydroxyphenyl)-2-phenyl- |
| Synonyms: | Acetophenone,2',4'-dihydroxy-2-phenyl- (6CI,7CI,8CI);1-(2,4-Dihydroxyphenyl)-2-phenylethanone;2,4-Dihydroxydeoxybenzoin;2,4-Dihydroxydesoxybenzoin;2,4-Dihydroxyphenyl benzyl ketone;2',4'-Dihydroxy-2-phenylacetophenone;4-(Phenylacetyl)resorcinol;Benzyl2,4-dihydroxyphenyl ketone;NSC 105542;w-Phenylresacetophenone; |
| CAS: | 3669-41-8 |
| Molecular Formula: | C14H12O3 |
| Molecular Weight: | 228.24 |
| InChI: | InChI=1/C14H12O3/c15-11-6-7-12(14(17)9-11)13(16)8-10-4-2-1-3-5-10/h1-7,9,15,17H,8H2 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 112-117 ºC |
| Flash Point: | 227.9°C |
| Boiling Point: | 429.8°C at 760 mmHg |
| Density: | 1.278g/cm3 |
| Refractive index: | 1.642 |
| Water Solubility: | Soluble in chloroform and methanol |
| Solubility: | Soluble in chloroform and methanol |
| Appearance: | off-white crystalline powder |
| Flash Point: | 227.9°C |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
