Identification |
Name: | Pentanoic acid,2-furanylmethyl ester |
Synonyms: | Furfurylpentanoate; Furfuryl valerate; Oxaromate 884 |
CAS: | 36701-01-6 |
EINECS: | 253-160-0 |
Molecular Formula: | C10H14 O3 |
Molecular Weight: | 182.22 |
InChI: | InChI=1/C10H14O3/c1-2-3-6-10(11)13-8-9-5-4-7-12-9/h4-5,7H,2-3,6,8H2,1H3 |
Molecular Structure: |
![(C10H14O3) Furfurylpentanoate; Furfuryl valerate; Oxaromate 884](https://img.guidechem.com/casimg/36701-01-6.gif) |
Properties |
Flash Point: | 98.3°C |
Boiling Point: | 230.2°Cat760mmHg |
Density: | 1.043g/cm3 |
Stability: | Stable at normal temperatures and pressures. |
Refractive index: | n20/D 1.46(lit.) |
Solubility: | Insoluble |
Appearance: | Liquid. |
Flash Point: | 98.3°C |
Storage Temperature: | Can discolor during storage. Protect from light, including direct sun rays. Keep away from heat, sparks and open flame. Keep containers tightly closed. Keep in original container. |
Safety Data |
|
![](/images/detail_15.png) |