| Identification | |
| Name: | Benzonitrile,4-(aminomethyl)-2-fluoro- |
| Synonyms: | 4-Aminomethyl-2-fluorobenzonitrile; |
| CAS: | 368426-73-7 |
| Molecular Formula: | C8H7FN2 |
| Molecular Weight: | 150.15 |
| InChI: | InChI=1/C8H7FN2/c9-8-3-6(4-10)1-2-7(8)5-11/h1-3H,4,10H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.202 g/cm3 |
| Refractive index: | 1.548 |
| Specification: |
The 4-(Aminomethyl)-2-fluorobenzonitrile is an organic compound with the formula C8H7FN2. The systematic name of this chemical is 4-(aminomethyl)-2-fluorobenzonitrile. With the CAS registry number 368426-73-7, it is also named as benzonitrile, 4-(aminomethyl)-2-fluoro-. The product's category is Halide. Physical properties about this chemical are: (1)ACD/LogP: 1.56; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 5; (6)#H bond acceptors: 2; (7)#H bond donors: 2; (8)#Freely Rotating Bonds: 2; (9)Polar Surface Area: 49.81Å2; (10)Index of Refraction: 1.548; (11)Molar Refractivity: 39.681 cm3; (12)Molar Volume: 124.884 cm3; (13)Polarizability: 15.731×10-24cm3; (14)Surface Tension: 47.815 dyne/cm; (15)Density: 1.202 g/cm3; (16)Flash Point: 115.429 °C; (17)Enthalpy of Vaporization: 50.527 kJ/mol; (18)Boiling Point: 267.25 °C at 760 mmHg; (19)Vapour Pressure: 0.008 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
