| Identification | |
| Name: | 1,2-Benzisoxazole-6-methanamine,3-amino- |
| Synonyms: | 6-(Aminomethyl)-1,2-benzisoxazol-3-amine;3-Amino-1,2-benzisoxazole-6-methanamine; |
| CAS: | 368426-78-2 |
| Molecular Formula: | C8H9N3O |
| Molecular Weight: | 163.18 |
| InChI: | InChI=1/C8H9N3O/c9-4-5-1-2-6-7(3-5)12-11-8(6)10/h1-3H,4,9H2,(H2,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.339 g/cm3 |
| Refractive index: | 1.702 |
| Specification: |
The 3-Amino-1,2-benzisoxazole-6-methanamine with the cas number 368426-78-2 is also called 1,2-Benzisoxazole-6-methanamine,3-amino-. The systematic name is 6-(aminomethyl)-1,2-benzoxazol-3-amine. Its molecular formula is C8H9N3O. The product's category is OXAZOLE. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 1.01; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 4; (8)#H bond donors: 4; (9)#Freely Rotating Bonds: 2; (10)Polar Surface Area: 78.07 Å2; (11)Index of Refraction: 1.702; (12)Molar Refractivity: 47.174 cm3; (13)Molar Volume: 121.836 cm3; (14)Polarizability: 18.701×10-24cm3; (15)Surface Tension: 68.817 dyne/cm ; (16)Enthalpy of Vaporization: 63.745 kJ/mol ; (17)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
