| Identification |
| Name: | L-Ornithine,N5-(1-iminoethyl)- |
| Synonyms: | (S)-5-Acetimidoylamino-2-amino-pentanoic acid; |
| CAS: | 36889-13-1 |
| Molecular Formula: | C7H15N3O2 |
| Molecular Weight: | 173.2129 |
| InChI: | InChI=1S/C7H15N3O2/c1-5(8)10-4-2-3-6(9)7(11)12/h6H,2-4,9H2,1H3,(H2,8,10)(H,11,12)/t6-/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.26 g/cm3 |
| Water Solubility: | Soluble. |
| Solubility: | Soluble. |
| Appearance: | white powder. |
| Biological Activity: | Potent inhibitor of endothelial NO synthase (IC 50 = 500 nM). Also inhibits iNOS and nNOS. Active in vivo . |
| Storage Temperature: | -20°C |
| Usage: | A potent and reversible inhibitor of NO synthase of adrenal glands, brain, and vascular endothelial cells |
| Safety Data |
| |
 |
