| Identification | |
| Name: | 2-Isopropylimidazole |
| Synonyms: | - |
| CAS: | 36947-68-9 |
| EINECS: | 253-286-6 |
| Molecular Formula: | C6H10N2 |
| Molecular Weight: | 110.16 |
| InChI: | InChI=1/C6H10N2/c1-5(2)6-7-3-4-8-6/h3-5H,1-2H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 0.991 g/cm3 |
| Refractive index: | 1.505 |
| Appearance: | white to yellowish crystals |
| Specification: |
1H-Imidazole,2-(1-methylethyl)- , its cas register number is 36947-68-9. It also can be called 2-Isopropyl-1H-imidazole ; and 2-Isopropylimidazole . |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
