| Identification | |
| Name: | 8-Quinolinamine,5,6,7,8-tetrahydro-, (8S)- |
| Synonyms: | (S)-(+)-8-Amino-5,6,7,8-tetrahydroquinoline;(S)-5,6,7,8-Tetrahydroquinolin-8-ylamine |
| CAS: | 369656-57-5 |
| Molecular Formula: | C9H12 N2 |
| Molecular Weight: | 148.21 |
| InChI: | InChI=1/C9H12N2/c10-8-5-1-3-7-4-2-6-11-9(7)8/h2,4,6,8H,1,3,5,10H2/t8-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 146°C |
| Boiling Point: | 277.3°C at 760 mmHg |
| Density: | 1.081g/cm3 |
| Refractive index: | 1.565 |
| Specification: |
The (8S)-5,6,7,8-Tetrahydro-8-quinolinamine with the cas number 369656-57-5 is also called 8-Quinolinamine,5,6,7,8-tetrahydro-, (8S)-. Its molecular formula is C9H12N2. This chemical belongs to the following product categories: (1)PYRIDINE; (2)AMINEPRIMARY; (3)Quinoline Derivertives. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 0.68; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 4.06; (7)#H bond acceptors: 2; (8)#H bond donors: 2; (9)#Freely Rotating Bonds: 1; (10)Polar Surface Area: 16.13 Å2; (11)Index of Refraction: 1.565; (12)Molar Refractivity: 44.68 cm3; (13)Molar Volume: 137 cm3; (14)Polarizability: 17.71×10-24cm3; (15)Surface Tension: 46.3 dyne/cm ; (16)Enthalpy of Vaporization: 51.59 kJ/mol; (17)Vapour Pressure: 0.00456 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 146°C |
| Safety Data | |
 |
|
