| Identification | |
| Name: | Benzenemethanol, a-[(butylamino)methyl]-4-hydroxy- |
| CAS: | 3703-79-5 |
| EINECS: | 223-043-9 |
| Molecular Formula: | C12H19 N O2 |
| Molecular Weight: | 209.32 |
| InChI: | InChI=1/C12H19NO2/c1-2-3-8-13-9-12(15)10-4-6-11(14)7-5-10/h4-7,12-15H,2-3,8-9H2,1H3 |
| Molecular Structure: | ![(C12H19NO2) Benzylalcohol, a-[(butylamino)methyl]-p-hydroxy-(6CI,8CI); (?à)-Bamethane;1-(4-Hydroxyphenyl)-2-(N-...](https://img1.guidechem.com/chem/e/dict/38/3703-79-5.jpg) |
| Properties | |
| Flash Point: | 141.2°C |
| Boiling Point: | 375.2°Cat760mmHg |
| Density: | 1.079g/cm3 |
| Refractive index: | 1.545 |
| Specification: |
Bamethan ,its cas register number is 3703-79-5.It also can be called 1-(4-Hydroxyphenyl)-1-hydroxy-2-butylaminoethane ; 1-(p-Hydroxyphenyl)-2-butylaminoethanol ; 2-Butylamino-1-p-hydroxyphenylethanol and so on. |
| Flash Point: | 141.2°C |
| Safety Data | |
 |
|
