| Identification | |
| Name: | 2-Fluoroethyl gamma-fluorobutyrate |
| Synonyms: | 4-Fluorobutyric acid 2-fluoroethyl ester |
| CAS: | 371-29-9 |
| Molecular Formula: | C6H10F2O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H10F2O2/c7-3-1-2-6(9)10-5-4-8/h1-5H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 44.8°C |
| Boiling Point: | 151.4°C at 760 mmHg |
| Density: | 1.071g/cm3 |
| Refractive index: | 1.367 |
| Specification: |
2-Fluoroethyl gamma-fluorobutyrate with cas registry number of 371-29-9 is also known as 3-02-00-00621 (Beilstein Handbook Reference) ; TL 1127 ; beta-Fluoroethyl gamma-fluorobutyrate ; Butyric acid, 4-fluoro-, 2-fluoroethyl ester . |
| Flash Point: | 44.8°C |
| Safety Data | |
 |
|
