Identification |
Name: | 4-Fluorothiophenol |
Synonyms: | 4-Fluorobenzene-1-thiol; Fluorothiophenol2; 4-Fluorobenzenethiol; 4-Fluoro Thiophenol; p-Fluorothiophenol |
CAS: | 371-42-6 |
EINECS: | 206-737-6 |
Molecular Formula: | C6H5FS |
Molecular Weight: | 128.16 |
InChI: | InChI=1/C6H5FS/c7-5-1-3-6(8)4-2-5/h1-4,8H |
Molecular Structure: |
![(C6H5FS) 4-Fluorobenzene-1-thiol; Fluorothiophenol2; 4-Fluorobenzenethiol; 4-Fluoro Thiophenol; p-Fluorothiop...](https://img.guidechem.com/casimg/371-42-6.gif) |
Properties |
Transport: | UN 3336 |
Density: | 1.203 |
Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. Air sensitive |
Refractive index: | 1.548-1.55 |
Solubility: | Slightly soluble |
Appearance: | clear colorless to light yellow liquid |
Packinggroup: | III |
HS Code: | 29309070 |
Storage Temperature: | Flammables area |
Sensitive: | Stench |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
![](/images/detail_15.png) |