| Identification |
| Name: | 4-Fluorothiophenol |
| Synonyms: | 4-Fluorobenzene-1-thiol; Fluorothiophenol2; 4-Fluorobenzenethiol; 4-Fluoro Thiophenol; p-Fluorothiophenol |
| CAS: | 371-42-6 |
| EINECS: | 206-737-6 |
| Molecular Formula: | C6H5FS |
| Molecular Weight: | 128.16 |
| InChI: | InChI=1/C6H5FS/c7-5-1-3-6(8)4-2-5/h1-4,8H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3336 |
| Density: | 1.203 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. Air sensitive |
| Refractive index: | 1.548-1.55 |
| Solubility: | Slightly soluble |
| Appearance: | clear colorless to light yellow liquid |
| Packinggroup: | III |
| HS Code: | 29309070 |
| Storage Temperature: | Flammables area |
| Sensitive: | Stench |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
