Identification |
Name: | 6,8-Dioxabicyclo[3.2.1]oct-2-en-4-one,(1S,5R)- |
Synonyms: | 6,8-Dioxabicyclo[3.2.1]oct-2-en-4-one,(1S)-; Levoglucosenone |
CAS: | 37112-31-5 |
Molecular Formula: | C6H6 O3 |
Molecular Weight: | 126.11 |
InChI: | InChI=1/C6H6O3/c7-5-2-1-4-3-8-6(5)9-4/h1-2,4,6H,3H2/t4?,6-/m1/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 98.2°C |
Boiling Point: | 254.4°Cat760mmHg |
Density: | 1.329g/cm3 |
Refractive index: | 1.516 |
Flash Point: | 98.2°C |
Usage: | (-)-Form is a pyrolysis product of cellulose and cellulose-containing materials including pulp and paper waste products.
Known as a pyrolytic product of cellulose, its very useful as a chiral source for synthesizing natural products because of its |
Safety Data |
|
|