| Identification |
| Name: | ethenyl acetate - 2-methyl-N-(1-phenylpropan-2-yl)prop-2-enamide (1:1) |
| Synonyms: | N-Methacryloyl-DL-amphetamine, copolymer with vinyl acetate;Methacrylamide, N-(alpha-methylphenethyl)-, polymer with vinyl acetate;ethenyl acetate- 2-methyl-n-(1-phenylpropan-2-yl)prop-2-enamide(1:1);Acetic acid, vinyl ester, polymer with (+-)-N-(alpha-methylphenethyl)methacrylamide;37129-94-5;AC1Q5X9R;AC1L5080;AR-1I7788;LS-13008;ethenyl acetate; 2-methyl-N-(1-phenylpropan-2-yl)prop-2-enamide;ethenyl acetate - 2-methyl-N-(1-phenylpropan-2-yl)prop-2-enamide (1:1) |
| CAS: | 37129-94-5 |
| Molecular Formula: | C17H23NO3 |
| Molecular Weight: | 289.3694 |
| InChI: | InChI=1/C13H17NO.C4H6O2/c1-10(2)13(15)14-11(3)9-12-7-5-4-6-8-12;1-3-6-4(2)5/h4-8,11H,1,9H2,2-3H3,(H,14,15);3H,1H2,2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 226.5°C |
| Boiling Point: | 376.9°C at 760 mmHg |
| Flash Point: | 226.5°C |
| Safety Data |
| |
 |
