| Identification | |
| Name: | 5-Pyrimidinecarboxylicacid, 2,4-dichloro- |
| Synonyms: | 2,4-Dichloro-5-pyrimidinecarboxylicacid; |
| CAS: | 37131-89-8 |
| Molecular Formula: | C5H2Cl2N2O2 |
| Molecular Weight: | 192.99 |
| InChI: | InChI=1/C5H2Cl2N2O2/c6-3-2(4(10)11)1-8-5(7)9-3/h1H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 96-97 oC |
| Density: | 1.718 |
| Refractive index: | 1.614 |
| Specification: |
The systematic name of 2,4-Dichloropyrimidine-5-carboxylic acid is 2,4-Dichloropyrimidine-5-carboxylic acid. With the CAS registry number 37131-89-8, it is also named as 2,4-Dichloro-5-pyrimidinecarboxylic acid. The product's category is pyrimidine series. In addition, its molecular formula is C5H2Cl2N2O2 and its molecular weight is 192.99. The other characteristics of 2,4-Dichloropyrimidine-5-carboxylic acid can be summarized as: (1)ACD/LogP: 0.58; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)H bond acceptors: 4; (8)H bond donors: 1; (9)Freely Rotating Bonds: 1; (10)Polar Surface Area: 63.08 Å2; (11)Index of Refraction: 1.614; (12)Molar Refractivity: 39.155 cm3; (13)Molar Volume: 112.312 cm3; (14)Polarizability: 15.522×10-24cm3; (15)Surface Tension: 74.024 dyne/cm; (16)Density: 1.718 g/cm3; (17)Flash Point: 176.592 °C; (18)Melting point: 96-97 °C; (19)Enthalpy of Vaporization: 64.887 kJ/mol; (20)Boiling Point: 368.384 °C at 760 mmHg; (21)Vapour Pressure: 0 mmHg at 25 °C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
