Identification |
Name: | 3-Fluorophenol |
Synonyms: | Fluorophenolcolorlessliq |
CAS: | 372-20-3 |
EINECS: | 206-748-6 |
Molecular Formula: | C6H5FO |
Molecular Weight: | 112.1 |
InChI: | InChI=1/C6H5FO/c7-5-2-1-3-6(8)4-5/h1-4,8H |
Molecular Structure: |
 |
Properties |
Transport: | UN 2810 |
Density: | 1.238 |
Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, acid halides. |
Refractive index: | 1.5125-1.5155 |
Water Solubility: | insoluble |
Solubility: | insoluble |
Appearance: | colourless to light yellow liquid |
Specification: |
Hazardous Decomposition Products: Carbon monoxide, carbon dioxide, hydrogen fluoride gas, hydrocarbons, fluorine.
Hazardous Polymerization: Has not been reported.?
?
|
Packinggroup: | III |
HS Code: | 29081000 |
Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |