| Identification |
| Name: | Cyclobutanecarboxylic acid |
| Synonyms: | cyclobutane carboxylic acid; Cyclobutanecarboxylic acid |
| CAS: | 3721-95-7 |
| EINECS: | 223-072-7 |
| Molecular Formula: | C5H8O2 |
| Molecular Weight: | 100.12 |
| InChI: | InChI=1/C5H8O2/c6-5(7)4-2-1-3-4/h4H,1-3H2,(H,6,7) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3265 |
| Density: | 1.047 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.441-1.445 |
| Solubility: | Very soluble |
| Appearance: | Clear, colorless liquid. |
| Packinggroup: | III |
| HS Code: | 29162000 |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
