| Identification |
| Name: | (Chloromethylene)-dimethylammonium chloride |
| Synonyms: | (Chloromethylene)dimethyliminium chloride |
| CAS: | 3724-43-4 |
| EINECS: | 425-970-6 |
| Molecular Formula: | C3H7Cl2N |
| Molecular Weight: | 128 |
| InChI: | InChI=1/C3H7ClN.ClH/c1-5(2)3-4;/h3H,1-2H3;1H/q+1;/p-1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3261 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Stability: | Stable under normal temperatures and pressures. Combines vigorously with water with the evolution of heat. |
| Water Solubility: | reacts |
| Solubility: | REACTS with water |
| Appearance: | White to off-white powder |
| Packinggroup: | II |
| HS Code: | 29252000 |
| Flash Point: | °C |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
