Identification |
Name: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with ethenylmethylbenzene |
Synonyms: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with ethenylmethylbenzene |
CAS: | 37273-61-3 |
Molecular Formula: | C14H18O2 |
Molecular Weight: | 0 |
InChI: | InChI=1/C9H10.C5H8O2/c1-3-9-7-5-4-6-8(9)2;1-4(2)5(6)7-3/h3-7H,1H2,2H3;1H2,2-3H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 44.6°C |
Boiling Point: | 169.8°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 44.6°C |
Safety Data |
|
 |