| Identification | |
| Name: | chloroflurenol methyl ester |
| Synonyms: | Methyl-2,7-dichloro-9-hydroxyfluorene-9-carboxylate, mixt. with methyl 2-chloro-9-hydroxyfluorene-9-carboxylate and methyl 9-hydroxyfluorene-9-carboxylate;9H-Fluorene-9-carboxylic acid, 2,7-dichloro-9-hydroxy-, methyl ester, mixt. with methyl 2-chlo;9H-Fluorene-9-carboxylic acid, 2,7-dichloro-9-hydroxy-, methyl ester, mixt. with methyl 2-chloro-9-hydroxy-9H-fluorene-9-carboxylate and methyl 9-hydroxy-9H-fluorene-9-carboxylate |
| CAS: | 37339-61-0 |
| Molecular Formula: | C15H11ClO3 |
| Molecular Weight: | 274.70 |
| InChI: | InChI=1/C15H11ClO3/c1-19-14(17)15(18)12-5-3-2-4-10(12)11-7-6-9(16)8-13(11)15/h2-8,18H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 268-269 deg C |
| Safety Data | |
 |
|
