| Identification | |
| Name: | Antibioticum PA147 |
| Synonyms: | 5-hydroxy-3-vinyl-2(5H)-furanone;3-Carboxy-2,4-pentadienal lactol;3-Ethenyl-5-hydroxy-2(5H)-furanone;4-Hydroxy-2-vinyl-2-buten-4-olide;Antibiotic PA-147;PA-147 |
| CAS: | 3734-60-9 |
| Molecular Formula: | C6H6O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H6O3/c1-2-4-3-5(7)9-6(4)8/h2-3,5,7H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 176.3°C |
| Boiling Point: | 358.7°C at 760 mmHg |
| Density: | 1.476g/cm3 |
| Refractive index: | 1.676 |
| Specification: |
Antibioticum PA147 , its cas register number is 3734-60-9. It also can be called 5-Hydroxy-3-vinyl-2(5H)-furanone ; 3-Carboxy-2,4-pentadienallactol ; 3-Ethenyl-5-hydroxy-2(5H)-furanone ; and 4-03-00-01760 (Beilstein Handbook Reference) . And its classification code are Drug / Therapeutic Agent and Natural Product. |
| Flash Point: | 176.3°C |
| Safety Data | |
 |
|
