| Identification | |
| Name: | diethoxy-(4-nitrophenoxy)-thioxo-phosphorane; 3-[(2S)-2-piperidyl]pyridine; sulfuric acid |
| Synonyms: | Anabasine sulfate mixed with thiophos (1:1);Anabasine, sulfate mixed with phosphorothioic acid O,O-diethyl O-(p-nitrophenyl) ester (1:1);diethoxy-(4-nitrophenoxy)-thioxo-phosphorane; 3-[(2s)-2-piperidyl]pyridine; sulfuric acid;AC1Q6XBU;AC1L50RF;AR-1I4286;LS-19278 |
| CAS: | 37357-65-6 |
| Molecular Formula: | C20H30N3O9PS2 |
| Molecular Weight: | 551.5707 |
| InChI: | InChI=1/C10H14N2.C10H14NO5PS.H2O4S/c1-2-7-12-10(5-1)9-4-3-6-11-8-9;1-3-14-17(18,15-4-2)16-10-7-5-9(6-8-10)11(12)13;1-5(2,3)4/h3-4,6,8,10,12H,1-2,5,7H2;5-8H,3-4H2,1-2H3;(H2,1,2,3,4)/t10-;;/m0../s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 173.5°C |
| Boiling Point: | 375°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 173.5°C |
| Safety Data | |
 |
|
