Identification |
Name: | Fenclorim |
Synonyms: | Pyrimidine, 4,6-dichloro-2-phenyl-;CGA 123407;5-23-08-00007 (Beilstein Handbook Reference);CGA-123407;4,6-Dichloro-2-phenylpyrimidine;2-Phenyl-4,6-Dichloro Pyrimidine; |
CAS: | 3740-92-9 |
Molecular Formula: | C10H6Cl2N2 |
Molecular Weight: | 225.07404 |
InChI: | InChI=1S/C10H6Cl2N2/c11-8-6-9(12)14-10(13-8)7-4-2-1-3-5-7/h1-6H |
Molecular Structure: |
 |
Properties |
Transport: | 3077 |
Density: | 1.363 g/cm3 |
Refractive index: | 1.604 |
Water Solubility: | In water 2.5 mg/l (20 oC). In acetone 14%, cyclohexanone 28%, dichloromethane 40%, toluene 35%, xylene 30%, hexane 4%, methanol 1.9%, n-octanol 4.2%, and isopropanol 1.8%. |
Solubility: | In water 2.5 mg/l (20 oC). In acetone 14%, cyclohexanone 28%, dichloromethane 40%, toluene 35%, xylene 30%, hexane 4%, methanol 1.9%, n-octanol 4.2%, and isopropanol 1.8%. |
Appearance: | White to off-white solid |
Packinggroup: | III |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |