| Identification | |
| Name: | 1(2H)-Quinolineethanamine,3,4-dihydro- |
| Synonyms: | Quinoline,1-(2-aminoethyl)-1,2,3,4-tetrahydro- (7CI);N-(2-Aminoethyl)-1,2,3,4-tetrahydroquinoline; |
| CAS: | 37481-18-8 |
| Molecular Formula: | C11H16N2 |
| Molecular Weight: | 176.26 |
| InChI: | InChI=1/C11H16N2/c12-7-9-13-8-3-5-10-4-1-2-6-11(10)13/h1-2,4,6H,3,5,7-9,12H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.045 g/cm3 |
| Refractive index: | 1.564 |
| Specification: |
The N-(2-Aminoethyl)-1,2,3,4-tetrahydroquinoline with the CAS number 37481-18-8 is also called 1(2H)-Quinolineethanamine,3,4-dihydro-. The systematic name is 2-(3,4-dihydroquinolin-1(2H)-yl)ethanamine. Its molecular formula is C11H16N2. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the N-(2-Aminoethyl)-1,2,3,4-tetrahydroquinoline are: (1)ACD/LogP: 1.82; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 7.4): 0.63; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 15.01; (8)#H bond acceptors: 2; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 3; (11)Polar Surface Area: 29.26 Å2; (12)Index of Refraction: 1.564; (13)Molar Refractivity: 54.85 cm3; (14)Molar Volume: 168.5 cm3; (15)Polarizability: 21.74×10-24cm3; (16)Surface Tension: 41.8 dyne/cm; (17)Enthalpy of Vaporization: 56.04 kJ/mol; (18)Vapour Pressure: 0.000352 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
