Identification |
Name: | Boronic acid,B-[(1E)-2-cyclohexylethenyl]- |
Synonyms: | Boronicacid, (2-cyclohexylethenyl)-, (E)-; Boronic acid, [(1E)-2-cyclohexylethenyl]-(9CI); trans-(2-Cyclohexylethenyl)boronic acid |
CAS: | 37490-33-8 |
Molecular Formula: | C8H15 B O2 |
Molecular Weight: | 154.01 |
InChI: | InChI=1/C8H15BO2/c10-9(11)7-6-8-4-2-1-3-5-8/h6-8,10-11H,1-5H2/b7-6+ |
Molecular Structure: |
![(C8H15BO2) Boronicacid, (2-cyclohexylethenyl)-, (E)-; Boronic acid, [(1E)-2-cyclohexylethenyl]-(9CI); trans-(2-...](https://img1.guidechem.com/chem/e/dict/28/37490-33-8.jpg) |
Properties |
Melting Point: | 106-111 ºC |
Flash Point: | 125.4°C |
Boiling Point: | 283.7°C at 760 mmHg |
Density: | 1.078g/cm3 |
Refractive index: | 1.546 |
Specification: |
2-Cyclohexylethenylboronic acid , with CAS number of 37490-33-8, can be called (E)-2-cyclohexylvinylboronic acid ; trans-(2-Cyclohexylvinyl)boronic acid ; 2-Cyclohexylethenylboronic acid . 2-Cyclohexylethenylboronic acid (CAS NO.37490-33-8) is a white to light yellow crystal powde.
|
Flash Point: | 125.4°C |
Safety Data |
|
 |