| Identification | |
| Name: | Cyclododecane,1-methoxy-1-methyl- |
| Synonyms: | 1-Methyl-1-methoxycyclododecane;1-Methylcyclododecyl methyl ether; Madrox |
| CAS: | 37514-30-0 |
| EINECS: | 253-534-3 |
| Molecular Formula: | C14H28 O |
| Molecular Weight: | 212.3715 |
| InChI: | InChI=1/C14H28O/c1-14(15-2)12-10-8-6-4-3-5-7-9-11-13-14/h3-13H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.85 g/cm3 |
| Refractive index: | 1.45 |
| Appearance: | Colourless to pale yellow liquid |
| Specification: |
1-Methoxy-1-methylcyclododecane with cas registry number of 37514-30-0 is also known as 1-Methoxy-1-methylcyclododecane ; 1-Methyl-1-methoxycyclododecane ; 1-Methylcyclododecyl methyl ether ; BRN 2238172 ; Madrox ; 1-Methoxy-1-methylcyclododecane ; Cyclododecane, 1-methoxy-1-methyl- . It is a compound with the appearance of colorless to pale yellow clear liquid. 1-Methoxy-1-methylcyclododecane with cas registry number of 37514-30-0 is used as an intermediate. |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
