| Identification |
| Name: | Benzenamine, 4-heptyl- |
| Synonyms: | Aniline,p-heptyl- (6CI,7CI); 4-Heptylaniline; 4-Heptylphenylamine; 4-n-Heptylaniline;p-Heptylaniline; p-n-Heptylaniline |
| CAS: | 37529-27-4 |
| Molecular Formula: | C13H21 N |
| Molecular Weight: | 191.31 |
| InChI: | InChI=1/C13H21N/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12/h8-11H,2-7,14H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.91 |
| Refractive index: | n20/D 1.52(lit.) |
| Water Solubility: | Nonsoluble in water. Fully miscible with ethanol, acetone, toluene |
| Solubility: | Nonsoluble in water. Fully miscible with ethanol, acetone, toluene |
| Appearance: | Light yellow to light tan liquid, aromatic amine odor |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
