Identification |
Name: | Benzenamine, 4-heptyl- |
Synonyms: | Aniline,p-heptyl- (6CI,7CI); 4-Heptylaniline; 4-Heptylphenylamine; 4-n-Heptylaniline;p-Heptylaniline; p-n-Heptylaniline |
CAS: | 37529-27-4 |
Molecular Formula: | C13H21 N |
Molecular Weight: | 191.31 |
InChI: | InChI=1/C13H21N/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12/h8-11H,2-7,14H2,1H3 |
Molecular Structure: |
 |
Properties |
Density: | 0.91 |
Refractive index: | n20/D 1.52(lit.) |
Water Solubility: | Nonsoluble in water. Fully miscible with ethanol, acetone, toluene |
Solubility: | Nonsoluble in water. Fully miscible with ethanol, acetone, toluene |
Appearance: | Light yellow to light tan liquid, aromatic amine odor |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |